C19H28N4O3S2 — CID 165424235
4-[2-(2-methoxyethylamino)-1,3-thiazol-4-yl]-N,N-dimethyl-4-phenylpiperidine-1-sulfonamide (PubChem CID 165424235) has the molecular formula C19H28N4O3S2 and a molecular weight of 424.59 g/mol. Its IUPAC name is 4-[2-(2-methoxyethylamino)-1,3-thiazol-4-yl]-N,N-dimethyl-4-phenylpiperidine-1-sulfonamide.
| Compound Name | 4-[2-(2-methoxyethylamino)-1,3-thiazol-4-yl]-N,N-dimethyl-4-phenylpiperidine-1-sulfonamide |
|---|---|
| PubChem CID | 165424235 |
| Molecular Formula | C19H28N4O3S2 |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | 4-[2-(2-methoxyethylamino)-1,3-thiazol-4-yl]-N,N-dimethyl-4-phenylpiperidine-1-sulfonamide |
| SMILES | COCCNc1nc(C2(c3ccccc3)CCN(S(=O)(=O)N(C)C)CC2)cs1 |
| InChI | InChI=1S/C19H28N4O3S2/c1-22(2)28(24,25)23-12-9-19(10-13-23,16-7-5-4-6-8-16)17-15-27-18(21-17)20-11-14-26-3/h4-8,15H,9-14H2,1-3H3,(H,20,21) |
| InChIKey | ITXOSFKQIAADQE-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|