C24H32N4O2 — CID 165425739
(1R,2S,8S,9S)-11-[(9-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl]-8-propyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one (PubChem CID 165425739) has the molecular formula C24H32N4O2 and a molecular weight of 408.55 g/mol. Its IUPAC name is (1R,2S,8S,9S)-11-[(9-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl]-8-propyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one.
| Compound Name | (1R,2S,8S,9S)-11-[(9-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl]-8-propyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one |
|---|---|
| PubChem CID | 165425739 |
| Molecular Formula | C24H32N4O2 |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.25 |
| IUPAC Name | (1R,2S,8S,9S)-11-[(9-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)methyl]-8-propyl-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one |
| SMILES | CCC[C@H]1[C@H]2C[C@H](CN(Cc3cc(=O)n4cccc(C)c4n3)C2)[C@@H]2CCCC(=O)N21 |
| InChI | InChI=1S/C24H32N4O2/c1-3-6-20-17-11-18(21-8-4-9-22(29)28(20)21)14-26(13-17)15-19-12-23(30)27-10-5-7-16(2)24(27)25-19/h5,7,10,12,17-18,20-21H,3-4,6,8-9,11,13-15H2,1-2H3/t17-,18+,20-,21-/m0/s1 |
| InChIKey | TUFBRTRQDKPLFL-YHELAOLJSA-N |
| XLogP | 3.00 |
| TPSA | 57.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |