C24H23N3O3 — CID 165426040
4-methoxy-3-[1-[(3S,4S)-4-(quinolin-4-ylmethyl)oxolan-3-yl]imidazol-2-yl]phenol (PubChem CID 165426040) has the molecular formula C24H23N3O3 and a molecular weight of 401.47 g/mol. Its IUPAC name is 4-methoxy-3-[1-[(3S,4S)-4-(quinolin-4-ylmethyl)oxolan-3-yl]imidazol-2-yl]phenol.
| Compound Name | 4-methoxy-3-[1-[(3S,4S)-4-(quinolin-4-ylmethyl)oxolan-3-yl]imidazol-2-yl]phenol |
|---|---|
| PubChem CID | 165426040 |
| Molecular Formula | C24H23N3O3 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | 4-methoxy-3-[1-[(3S,4S)-4-(quinolin-4-ylmethyl)oxolan-3-yl]imidazol-2-yl]phenol |
| SMILES | COc1ccc(O)cc1-c1nccn1[C@@H]1COC[C@H]1Cc1ccnc2ccccc12 |
| InChI | InChI=1S/C24H23N3O3/c1-29-23-7-6-18(28)13-20(23)24-26-10-11-27(24)22-15-30-14-17(22)12-16-8-9-25-21-5-3-2-4-19(16)21/h2-11,13,17,22,28H,12,14-15H2,1H3/t17-,22-/m1/s1 |
| InChIKey | PTQAFUGJEWRESH-VGOFRKELSA-N |
| XLogP | 4.24 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |