C25H28N2O4 — CID 134696924
3-methoxy-4-propan-2-yloxy-N-[(3R,4S)-4-(quinolin-4-ylmethyl)oxolan-3-yl]benzamide (PubChem CID 134696924) has the molecular formula C25H28N2O4 and a molecular weight of 420.51 g/mol. Its IUPAC name is 3-methoxy-4-propan-2-yloxy-N-[(3R,4S)-4-(quinolin-4-ylmethyl)oxolan-3-yl]benzamide.
| Compound Name | 3-methoxy-4-propan-2-yloxy-N-[(3R,4S)-4-(quinolin-4-ylmethyl)oxolan-3-yl]benzamide |
|---|---|
| PubChem CID | 134696924 |
| Molecular Formula | C25H28N2O4 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | 3-methoxy-4-propan-2-yloxy-N-[(3R,4S)-4-(quinolin-4-ylmethyl)oxolan-3-yl]benzamide |
| SMILES | COc1cc(C(=O)N[C@H]2COC[C@H]2Cc2ccnc3ccccc23)ccc1OC(C)C |
| InChI | InChI=1S/C25H28N2O4/c1-16(2)31-23-9-8-18(13-24(23)29-3)25(28)27-22-15-30-14-19(22)12-17-10-11-26-21-7-5-4-6-20(17)21/h4-11,13,16,19,22H,12,14-15H2,1-3H3,(H,27,28)/t19-,22+/m1/s1 |
| InChIKey | BDYJZBRKJMNLQA-KNQAVFIVSA-N |
| XLogP | 4.02 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |