C22H21ClN2O3 — CID 135087222
3-chloro-4-methoxy-N-[(3S,4S)-4-(quinolin-4-ylmethyl)oxolan-3-yl]benzamide (PubChem CID 135087222) has the molecular formula C22H21ClN2O3 and a molecular weight of 396.87 g/mol. Its IUPAC name is 3-chloro-4-methoxy-N-[(3S,4S)-4-(quinolin-4-ylmethyl)oxolan-3-yl]benzamide.
| Compound Name | 3-chloro-4-methoxy-N-[(3S,4S)-4-(quinolin-4-ylmethyl)oxolan-3-yl]benzamide |
|---|---|
| PubChem CID | 135087222 |
| Molecular Formula | C22H21ClN2O3 |
| Molecular Weight | 396.87 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | 3-chloro-4-methoxy-N-[(3S,4S)-4-(quinolin-4-ylmethyl)oxolan-3-yl]benzamide |
| SMILES | COc1ccc(C(=O)N[C@@H]2COC[C@H]2Cc2ccnc3ccccc23)cc1Cl |
| InChI | InChI=1S/C22H21ClN2O3/c1-27-21-7-6-15(11-18(21)23)22(26)25-20-13-28-12-16(20)10-14-8-9-24-19-5-3-2-4-17(14)19/h2-9,11,16,20H,10,12-13H2,1H3,(H,25,26)/t16-,20-/m1/s1 |
| InChIKey | VQEZKYFKQCXQQN-OXQOHEQNSA-N |
| XLogP | 3.88 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.87 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |