C22H28N2O2 — CID 134705202
N-[(3S,4S)-4-(quinolin-4-ylmethyl)oxolan-3-yl]cycloheptanecarboxamide (PubChem CID 134705202) has the molecular formula C22H28N2O2 and a molecular weight of 352.48 g/mol. Its IUPAC name is N-[(3S,4S)-4-(quinolin-4-ylmethyl)oxolan-3-yl]cycloheptanecarboxamide.
| Compound Name | N-[(3S,4S)-4-(quinolin-4-ylmethyl)oxolan-3-yl]cycloheptanecarboxamide |
|---|---|
| PubChem CID | 134705202 |
| Molecular Formula | C22H28N2O2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | N-[(3S,4S)-4-(quinolin-4-ylmethyl)oxolan-3-yl]cycloheptanecarboxamide |
| SMILES | O=C(N[C@@H]1COC[C@H]1Cc1ccnc2ccccc12)C1CCCCCC1 |
| InChI | InChI=1S/C22H28N2O2/c25-22(16-7-3-1-2-4-8-16)24-21-15-26-14-18(21)13-17-11-12-23-20-10-6-5-9-19(17)20/h5-6,9-12,16,18,21H,1-4,7-8,13-15H2,(H,24,25)/t18-,21-/m1/s1 |
| InChIKey | DQDZCEQCXBVXKK-WIYYLYMNSA-N |
| XLogP | 3.88 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |