C19H21N3O3 — CID 135089561
1-N'-[(3R,4S)-4-(quinolin-4-ylmethyl)oxolan-3-yl]cyclopropane-1,1-dicarboxamide (PubChem CID 135089561) has the molecular formula C19H21N3O3 and a molecular weight of 339.39 g/mol. Its IUPAC name is 1-N'-[(3R,4S)-4-(quinolin-4-ylmethyl)oxolan-3-yl]cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-[(3R,4S)-4-(quinolin-4-ylmethyl)oxolan-3-yl]cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 135089561 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | 1-N'-[(3R,4S)-4-(quinolin-4-ylmethyl)oxolan-3-yl]cyclopropane-1,1-dicarboxamide |
| SMILES | NC(=O)C1(C(=O)N[C@H]2COC[C@H]2Cc2ccnc3ccccc23)CC1 |
| InChI | InChI=1S/C19H21N3O3/c20-17(23)19(6-7-19)18(24)22-16-11-25-10-13(16)9-12-5-8-21-15-4-2-1-3-14(12)15/h1-5,8,13,16H,6-7,9-11H2,(H2,20,23)(H,22,24)/t13-,16+/m1/s1 |
| InChIKey | DZYICKUELPOGAN-CJNGLKHVSA-N |
| XLogP | 1.17 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|