C18H25Cl2N3O2 — CID 154918903
4-amino-N-[(3S,4S)-4-(quinolin-4-ylmethyl)oxolan-3-yl]butanamide;dihydrochloride (PubChem CID 154918903) has the molecular formula C18H25Cl2N3O2 and a molecular weight of 386.32 g/mol. Its IUPAC name is 4-amino-N-[(3S,4S)-4-(quinolin-4-ylmethyl)oxolan-3-yl]butanamide;dihydrochloride.
| Compound Name | 4-amino-N-[(3S,4S)-4-(quinolin-4-ylmethyl)oxolan-3-yl]butanamide;dihydrochloride |
|---|---|
| PubChem CID | 154918903 |
| Molecular Formula | C18H25Cl2N3O2 |
| Molecular Weight | 386.32 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | 4-amino-N-[(3S,4S)-4-(quinolin-4-ylmethyl)oxolan-3-yl]butanamide;dihydrochloride |
| SMILES | Cl.Cl.NCCCC(=O)N[C@@H]1COC[C@H]1Cc1ccnc2ccccc12 |
| InChI | InChI=1S/C18H23N3O2.2ClH/c19-8-3-6-18(22)21-17-12-23-11-14(17)10-13-7-9-20-16-5-2-1-4-15(13)16;;/h1-2,4-5,7,9,14,17H,3,6,8,10-12,19H2,(H,21,22);2*1H/t14-,17-;;/m1../s1 |
| InChIKey | GTPFLQVDIMZOSD-LVVRIOTCSA-N |
| XLogP | 2.49 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.32 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |