C18H23N3O4S — CID 135087501
N-[(3S,4S)-4-(quinolin-4-ylmethyl)oxolan-3-yl]-4-sulfamoylbutanamide (PubChem CID 135087501) has the molecular formula C18H23N3O4S and a molecular weight of 377.47 g/mol. Its IUPAC name is N-[(3S,4S)-4-(quinolin-4-ylmethyl)oxolan-3-yl]-4-sulfamoylbutanamide.
| Compound Name | N-[(3S,4S)-4-(quinolin-4-ylmethyl)oxolan-3-yl]-4-sulfamoylbutanamide |
|---|---|
| PubChem CID | 135087501 |
| Molecular Formula | C18H23N3O4S |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | N-[(3S,4S)-4-(quinolin-4-ylmethyl)oxolan-3-yl]-4-sulfamoylbutanamide |
| SMILES | NS(=O)(=O)CCCC(=O)N[C@@H]1COC[C@H]1Cc1ccnc2ccccc12 |
| InChI | InChI=1S/C18H23N3O4S/c19-26(23,24)9-3-6-18(22)21-17-12-25-11-14(17)10-13-7-8-20-16-5-2-1-4-15(13)16/h1-2,4-5,7-8,14,17H,3,6,9-12H2,(H,21,22)(H2,19,23,24)/t14-,17-/m1/s1 |
| InChIKey | ZIFAAZPLIIDQMH-RHSMWYFYSA-N |
| XLogP | 0.98 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |