C21H26N2O2 — CID 134703831
N-[(3R,4S)-4-(quinolin-4-ylmethyl)oxolan-3-yl]cyclohexanecarboxamide (PubChem CID 134703831) has the molecular formula C21H26N2O2 and a molecular weight of 338.45 g/mol. Its IUPAC name is N-[(3R,4S)-4-(quinolin-4-ylmethyl)oxolan-3-yl]cyclohexanecarboxamide.
| Compound Name | N-[(3R,4S)-4-(quinolin-4-ylmethyl)oxolan-3-yl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 134703831 |
| Molecular Formula | C21H26N2O2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | N-[(3R,4S)-4-(quinolin-4-ylmethyl)oxolan-3-yl]cyclohexanecarboxamide |
| SMILES | O=C(N[C@H]1COC[C@H]1Cc1ccnc2ccccc12)C1CCCCC1 |
| InChI | InChI=1S/C21H26N2O2/c24-21(15-6-2-1-3-7-15)23-20-14-25-13-17(20)12-16-10-11-22-19-9-5-4-8-18(16)19/h4-5,8-11,15,17,20H,1-3,6-7,12-14H2,(H,23,24)/t17-,20+/m1/s1 |
| InChIKey | XKJMJZBDTRRIGU-XLIONFOSSA-N |
| XLogP | 3.49 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |