C23H23FN2O2 — CID 134701669
3-(2-fluorophenyl)-N-[(3S,4S)-4-(quinolin-4-ylmethyl)oxolan-3-yl]propanamide (PubChem CID 134701669) has the molecular formula C23H23FN2O2 and a molecular weight of 378.45 g/mol. Its IUPAC name is 3-(2-fluorophenyl)-N-[(3S,4S)-4-(quinolin-4-ylmethyl)oxolan-3-yl]propanamide.
| Compound Name | 3-(2-fluorophenyl)-N-[(3S,4S)-4-(quinolin-4-ylmethyl)oxolan-3-yl]propanamide |
|---|---|
| PubChem CID | 134701669 |
| Molecular Formula | C23H23FN2O2 |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | 3-(2-fluorophenyl)-N-[(3S,4S)-4-(quinolin-4-ylmethyl)oxolan-3-yl]propanamide |
| SMILES | O=C(CCc1ccccc1F)N[C@@H]1COC[C@H]1Cc1ccnc2ccccc12 |
| InChI | InChI=1S/C23H23FN2O2/c24-20-7-3-1-5-16(20)9-10-23(27)26-22-15-28-14-18(22)13-17-11-12-25-21-8-4-2-6-19(17)21/h1-8,11-12,18,22H,9-10,13-15H2,(H,26,27)/t18-,22-/m1/s1 |
| InChIKey | NJCFMJOKRMEYCL-XMSQKQJNSA-N |
| XLogP | 3.68 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |