About 3-pyrazin-2-yl-N-[(3S,4S)-4-(quinolin-4-ylmethyl)oxolan-3-yl]propanamide
3-pyrazin-2-yl-N-[(3S,4S)-4-(quinolin-4-ylmethyl)oxolan-3-yl]propanamide (PubChem CID 156584575) has the molecular formula C21H22N4O2
and a molecular weight of 362.43 g/mol. Its IUPAC name is 3-pyrazin-2-yl-N-[(3S,4S)-4-(quinolin-4-ylmethyl)oxolan-3-yl]propanamide.
Molecular Properties
| Compound Name | 3-pyrazin-2-yl-N-[(3S,4S)-4-(quinolin-4-ylmethyl)oxolan-3-yl]propanamide |
| PubChem CID | 156584575 |
| Molecular Formula | C21H22N4O2 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | 3-pyrazin-2-yl-N-[(3S,4S)-4-(quinolin-4-ylmethyl)oxolan-3-yl]propanamide |
| SMILES | O=C(CCc1cnccn1)N[C@@H]1COC[C@H]1Cc1ccnc2ccccc12 |
| InChI | InChI=1S/C21H22N4O2/c26-21(6-5-17-12-22-9-10-23-17)25-20-14-27-13-16(20)11-15-7-8-24-19-4-2-1-3-18(15)19/h1-4,7-10,12,16,20H,5-6,11,13-14H2,(H,25,26)/t16-,20-/m1/s1 |
| InChIKey | PCKSDRGTQSTHEC-OXQOHEQNSA-N |
| XLogP | 2.33 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-pyrazin-2-yl-N-[(3S,4S)-4-(quinolin-4-ylmethyl)oxolan-3-yl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pyrazin-2-yl-N-[(3S,4S)-4-(quinolin-4-ylmethyl)oxolan-3-yl]propanamide?
The IUPAC name of 3-pyrazin-2-yl-N-[(3S,4S)-4-(quinolin-4-ylmethyl)oxolan-3-yl]propanamide (CID 156584575) is 3-pyrazin-2-yl-N-[(3S,4S)-4-(quinolin-4-ylmethyl)oxolan-3-yl]propanamide.
What is the SMILES notation for 3-pyrazin-2-yl-N-[(3S,4S)-4-(quinolin-4-ylmethyl)oxolan-3-yl]propanamide?
The canonical SMILES for 3-pyrazin-2-yl-N-[(3S,4S)-4-(quinolin-4-ylmethyl)oxolan-3-yl]propanamide is O=C(CCc1cnccn1)N[C@@H]1COC[C@H]1Cc1ccnc2ccccc12.
What is the InChIKey of 3-pyrazin-2-yl-N-[(3S,4S)-4-(quinolin-4-ylmethyl)oxolan-3-yl]propanamide?
The InChIKey is PCKSDRGTQSTHEC-OXQOHEQNSA-N. The full InChI is InChI=1S/C21H22N4O2/c26-21(6-5-17-12-22-9-10-23-17)25-20-14-27-13-16(20)11-15-7-8-24-19-4-2-1-3-18(15)19/h1-4,7-10,12,16,20H,5-6,11,13-14H2,(H,25,26)/t16-,20-/m1/s1.
What are the key properties of 3-pyrazin-2-yl-N-[(3S,4S)-4-(quinolin-4-ylmethyl)oxolan-3-yl]propanamide?
3-pyrazin-2-yl-N-[(3S,4S)-4-(quinolin-4-ylmethyl)oxolan-3-yl]propanamide has a molecular weight of 362.43 g/mol, XLogP of 2.33, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pyrazin-2-yl-N-[(3S,4S)-4-(quinolin-4-ylmethyl)oxolan-3-yl]propanamide is sourced from PubChem (CID 156584575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).