C19H24N2O3 — CID 135116730
2-propan-2-yloxy-N-[(3S,4S)-4-(quinolin-4-ylmethyl)oxolan-3-yl]acetamide (PubChem CID 135116730) has the molecular formula C19H24N2O3 and a molecular weight of 328.41 g/mol. Its IUPAC name is 2-propan-2-yloxy-N-[(3S,4S)-4-(quinolin-4-ylmethyl)oxolan-3-yl]acetamide.
| Compound Name | 2-propan-2-yloxy-N-[(3S,4S)-4-(quinolin-4-ylmethyl)oxolan-3-yl]acetamide |
|---|---|
| PubChem CID | 135116730 |
| Molecular Formula | C19H24N2O3 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | 2-propan-2-yloxy-N-[(3S,4S)-4-(quinolin-4-ylmethyl)oxolan-3-yl]acetamide |
| SMILES | CC(C)OCC(=O)N[C@@H]1COC[C@H]1Cc1ccnc2ccccc12 |
| InChI | InChI=1S/C19H24N2O3/c1-13(2)24-12-19(22)21-18-11-23-10-15(18)9-14-7-8-20-17-6-4-3-5-16(14)17/h3-8,13,15,18H,9-12H2,1-2H3,(H,21,22)/t15-,18-/m1/s1 |
| InChIKey | XUGNTRHIXMYSPT-CRAIPNDOSA-N |
| XLogP | 2.33 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |