C19H19N3O2 — CID 156586814
N-[(3R,4S)-4-(quinolin-4-ylmethyl)oxolan-3-yl]-1H-pyrrole-3-carboxamide (PubChem CID 156586814) has the molecular formula C19H19N3O2 and a molecular weight of 321.38 g/mol. Its IUPAC name is N-[(3R,4S)-4-(quinolin-4-ylmethyl)oxolan-3-yl]-1H-pyrrole-3-carboxamide.
| Compound Name | N-[(3R,4S)-4-(quinolin-4-ylmethyl)oxolan-3-yl]-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 156586814 |
| Molecular Formula | C19H19N3O2 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | N-[(3R,4S)-4-(quinolin-4-ylmethyl)oxolan-3-yl]-1H-pyrrole-3-carboxamide |
| SMILES | O=C(N[C@H]1COC[C@H]1Cc1ccnc2ccccc12)c1cc[nH]c1 |
| InChI | InChI=1S/C19H19N3O2/c23-19(14-5-7-20-10-14)22-18-12-24-11-15(18)9-13-6-8-21-17-4-2-1-3-16(13)17/h1-8,10,15,18,20H,9,11-12H2,(H,22,23)/t15-,18+/m1/s1 |
| InChIKey | YFRHMTWFWAQCGN-QAPCUYQASA-N |
| XLogP | 2.55 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |