C20H22N4O2 — CID 134707923
1-ethyl-N-[(3R,4S)-4-(quinolin-4-ylmethyl)oxolan-3-yl]pyrazole-4-carboxamide (PubChem CID 134707923) has the molecular formula C20H22N4O2 and a molecular weight of 350.42 g/mol. Its IUPAC name is 1-ethyl-N-[(3R,4S)-4-(quinolin-4-ylmethyl)oxolan-3-yl]pyrazole-4-carboxamide.
| Compound Name | 1-ethyl-N-[(3R,4S)-4-(quinolin-4-ylmethyl)oxolan-3-yl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 134707923 |
| Molecular Formula | C20H22N4O2 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | 1-ethyl-N-[(3R,4S)-4-(quinolin-4-ylmethyl)oxolan-3-yl]pyrazole-4-carboxamide |
| SMILES | CCn1cc(C(=O)N[C@H]2COC[C@H]2Cc2ccnc3ccccc23)cn1 |
| InChI | InChI=1S/C20H22N4O2/c1-2-24-11-16(10-22-24)20(25)23-19-13-26-12-15(19)9-14-7-8-21-18-6-4-3-5-17(14)18/h3-8,10-11,15,19H,2,9,12-13H2,1H3,(H,23,25)/t15-,19+/m1/s1 |
| InChIKey | ZVAWOKUIZGWSRF-BEFAXECRSA-N |
| XLogP | 2.44 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |