C8H12N2O2S — CID 165431164
4-(hydroxymethyl)-3-[[(2S)-oxetan-2-yl]methyl]-1H-imidazole-2-thione (PubChem CID 165431164) has the molecular formula C8H12N2O2S and a molecular weight of 200.26 g/mol. Its IUPAC name is 4-(hydroxymethyl)-3-[[(2S)-oxetan-2-yl]methyl]-1H-imidazole-2-thione.
| Compound Name | 4-(hydroxymethyl)-3-[[(2S)-oxetan-2-yl]methyl]-1H-imidazole-2-thione |
|---|---|
| PubChem CID | 165431164 |
| Molecular Formula | C8H12N2O2S |
| Molecular Weight | 200.26 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | 4-(hydroxymethyl)-3-[[(2S)-oxetan-2-yl]methyl]-1H-imidazole-2-thione |
| SMILES | OCc1c[nH]c(=S)n1C[C@@H]1CCO1 |
| InChI | InChI=1S/C8H12N2O2S/c11-5-6-3-9-8(13)10(6)4-7-1-2-12-7/h3,7,11H,1-2,4-5H2,(H,9,13)/t7-/m0/s1 |
| InChIKey | UCTSVWQQMVVDRO-ZETCQYMHSA-N |
| XLogP | 0.83 |
| TPSA | 50.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.26 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|