C10H18N2O2S — CID 66146568
3-(2-butoxyethyl)-4-(hydroxymethyl)-1H-imidazole-2-thione (PubChem CID 66146568) has the molecular formula C10H18N2O2S and a molecular weight of 230.33 g/mol. Its IUPAC name is 3-(2-butoxyethyl)-4-(hydroxymethyl)-1H-imidazole-2-thione.
| Compound Name | 3-(2-butoxyethyl)-4-(hydroxymethyl)-1H-imidazole-2-thione |
|---|---|
| PubChem CID | 66146568 |
| Molecular Formula | C10H18N2O2S |
| Molecular Weight | 230.33 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 3-(2-butoxyethyl)-4-(hydroxymethyl)-1H-imidazole-2-thione |
| SMILES | CCCCOCCn1c(CO)c[nH]c1=S |
| InChI | InChI=1S/C10H18N2O2S/c1-2-3-5-14-6-4-12-9(8-13)7-11-10(12)15/h7,13H,2-6,8H2,1H3,(H,11,15) |
| InChIKey | URXITKLRHOPGSA-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 50.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.33 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|