C14H19N5O2 — CID 165431747
3-[[1-(cyclopropylmethyl)triazol-4-yl]methyl]-1,3-diazaspiro[4.4]nonane-2,4-dione (PubChem CID 165431747) has the molecular formula C14H19N5O2 and a molecular weight of 289.34 g/mol. Its IUPAC name is 3-[[1-(cyclopropylmethyl)triazol-4-yl]methyl]-1,3-diazaspiro[4.4]nonane-2,4-dione.
| Compound Name | 3-[[1-(cyclopropylmethyl)triazol-4-yl]methyl]-1,3-diazaspiro[4.4]nonane-2,4-dione |
|---|---|
| PubChem CID | 165431747 |
| Molecular Formula | C14H19N5O2 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | 3-[[1-(cyclopropylmethyl)triazol-4-yl]methyl]-1,3-diazaspiro[4.4]nonane-2,4-dione |
| SMILES | O=C1NC2(CCCC2)C(=O)N1Cc1cn(CC2CC2)nn1 |
| InChI | InChI=1S/C14H19N5O2/c20-12-14(5-1-2-6-14)15-13(21)19(12)9-11-8-18(17-16-11)7-10-3-4-10/h8,10H,1-7,9H2,(H,15,21) |
| InChIKey | OCNJMOVZBCRZHU-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|