About [1-(5,7-dimethyl-1,8-naphthyridin-2-yl)piperidin-4-yl]-morpholin-4-ylmethanone
[1-(5,7-dimethyl-1,8-naphthyridin-2-yl)piperidin-4-yl]-morpholin-4-ylmethanone (PubChem CID 165435169) has the molecular formula C20H26N4O2
and a molecular weight of 354.45 g/mol. Its IUPAC name is [1-(5,7-dimethyl-1,8-naphthyridin-2-yl)piperidin-4-yl]-morpholin-4-ylmethanone.
Molecular Properties
| Compound Name | [1-(5,7-dimethyl-1,8-naphthyridin-2-yl)piperidin-4-yl]-morpholin-4-ylmethanone |
| PubChem CID | 165435169 |
| Molecular Formula | C20H26N4O2 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | [1-(5,7-dimethyl-1,8-naphthyridin-2-yl)piperidin-4-yl]-morpholin-4-ylmethanone |
| SMILES | Cc1cc(C)c2ccc(N3CCC(C(=O)N4CCOCC4)CC3)nc2n1 |
| InChI | InChI=1S/C20H26N4O2/c1-14-13-15(2)21-19-17(14)3-4-18(22-19)23-7-5-16(6-8-23)20(25)24-9-11-26-12-10-24/h3-4,13,16H,5-12H2,1-2H3 |
| InChIKey | QMISRPXWESTVLK-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1-(5,7-dimethyl-1,8-naphthyridin-2-yl)piperidin-4-yl]-morpholin-4-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(5,7-dimethyl-1,8-naphthyridin-2-yl)piperidin-4-yl]-morpholin-4-ylmethanone?
The IUPAC name of [1-(5,7-dimethyl-1,8-naphthyridin-2-yl)piperidin-4-yl]-morpholin-4-ylmethanone (CID 165435169) is [1-(5,7-dimethyl-1,8-naphthyridin-2-yl)piperidin-4-yl]-morpholin-4-ylmethanone.
What is the SMILES notation for [1-(5,7-dimethyl-1,8-naphthyridin-2-yl)piperidin-4-yl]-morpholin-4-ylmethanone?
The canonical SMILES for [1-(5,7-dimethyl-1,8-naphthyridin-2-yl)piperidin-4-yl]-morpholin-4-ylmethanone is Cc1cc(C)c2ccc(N3CCC(C(=O)N4CCOCC4)CC3)nc2n1.
What is the InChIKey of [1-(5,7-dimethyl-1,8-naphthyridin-2-yl)piperidin-4-yl]-morpholin-4-ylmethanone?
The InChIKey is QMISRPXWESTVLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26N4O2/c1-14-13-15(2)21-19-17(14)3-4-18(22-19)23-7-5-16(6-8-23)20(25)24-9-11-26-12-10-24/h3-4,13,16H,5-12H2,1-2H3.
What are the key properties of [1-(5,7-dimethyl-1,8-naphthyridin-2-yl)piperidin-4-yl]-morpholin-4-ylmethanone?
[1-(5,7-dimethyl-1,8-naphthyridin-2-yl)piperidin-4-yl]-morpholin-4-ylmethanone has a molecular weight of 354.45 g/mol, XLogP of 2.32, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(5,7-dimethyl-1,8-naphthyridin-2-yl)piperidin-4-yl]-morpholin-4-ylmethanone is sourced from PubChem (CID 165435169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).