C29H31F3O7S2 — CID 165436430
methyl 5-(2,5-dimethyl-4-phenoxathiin-10-ium-10-ylphenoxy)-2,2-dimethylpentanoate;trifluoromethanesulfonate (PubChem CID 165436430) has the molecular formula C29H31F3O7S2 and a molecular weight of 612.69 g/mol. Its IUPAC name is methyl 5-(2,5-dimethyl-4-phenoxathiin-10-ium-10-ylphenoxy)-2,2-dimethylpentanoate;trifluoromethanesulfonate.
| Compound Name | methyl 5-(2,5-dimethyl-4-phenoxathiin-10-ium-10-ylphenoxy)-2,2-dimethylpentanoate;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 165436430 |
| Molecular Formula | C29H31F3O7S2 |
| Molecular Weight | 612.69 g/mol |
| Exact Mass | 612.15 |
| IUPAC Name | methyl 5-(2,5-dimethyl-4-phenoxathiin-10-ium-10-ylphenoxy)-2,2-dimethylpentanoate;trifluoromethanesulfonate |
| SMILES | COC(=O)C(C)(C)CCCOc1cc(C)c([S+]2c3ccccc3Oc3ccccc32)cc1C.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C28H31O4S.CHF3O3S/c1-19-18-26(20(2)17-23(19)31-16-10-15-28(3,4)27(29)30-5)33-24-13-8-6-11-21(24)32-22-12-7-9-14-25(22)33;2-1(3,4)8(5,6)7/h6-9,11-14,17-18H,10,15-16H2,1-5H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | QOMWTXPQIRXKMD-UHFFFAOYSA-M |
| XLogP | 6.91 |
| TPSA | 101.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.69 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|