C22H28O3S — CID 164667541
methyl 5-(2,5-dimethyl-4-phenylsulfanylphenoxy)-2,2-dimethylpentanoate (PubChem CID 164667541) has the molecular formula C22H28O3S and a molecular weight of 372.53 g/mol. Its IUPAC name is methyl 5-(2,5-dimethyl-4-phenylsulfanylphenoxy)-2,2-dimethylpentanoate.
| Compound Name | methyl 5-(2,5-dimethyl-4-phenylsulfanylphenoxy)-2,2-dimethylpentanoate |
|---|---|
| PubChem CID | 164667541 |
| Molecular Formula | C22H28O3S |
| Molecular Weight | 372.53 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | methyl 5-(2,5-dimethyl-4-phenylsulfanylphenoxy)-2,2-dimethylpentanoate |
| SMILES | COC(=O)C(C)(C)CCCOc1cc(C)c(Sc2ccccc2)cc1C |
| InChI | InChI=1S/C22H28O3S/c1-16-15-20(26-18-10-7-6-8-11-18)17(2)14-19(16)25-13-9-12-22(3,4)21(23)24-5/h6-8,10-11,14-15H,9,12-13H2,1-5H3 |
| InChIKey | WAGKGIZIJSHNJO-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.53 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|