C26H37FO3S2 — CID 164597383
5-(3-fluoro-4-propyl-2-sulfanylidenethiochromen-6-yl)oxypentyl 2,2,5-trimethylhexanoate (PubChem CID 164597383) has the molecular formula C26H37FO3S2 and a molecular weight of 480.71 g/mol. Its IUPAC name is 5-(3-fluoro-4-propyl-2-sulfanylidenethiochromen-6-yl)oxypentyl 2,2,5-trimethylhexanoate.
| Compound Name | 5-(3-fluoro-4-propyl-2-sulfanylidenethiochromen-6-yl)oxypentyl 2,2,5-trimethylhexanoate |
|---|---|
| PubChem CID | 164597383 |
| Molecular Formula | C26H37FO3S2 |
| Molecular Weight | 480.71 g/mol |
| Exact Mass | 480.22 |
| IUPAC Name | 5-(3-fluoro-4-propyl-2-sulfanylidenethiochromen-6-yl)oxypentyl 2,2,5-trimethylhexanoate |
| SMILES | CCCc1c(F)c(=S)sc2ccc(OCCCCCOC(=O)C(C)(C)CCC(C)C)cc12 |
| InChI | InChI=1S/C26H37FO3S2/c1-6-10-20-21-17-19(11-12-22(21)32-24(31)23(20)27)29-15-8-7-9-16-30-25(28)26(4,5)14-13-18(2)3/h11-12,17-18H,6-10,13-16H2,1-5H3 |
| InChIKey | QFKBBXWBJGJHTO-UHFFFAOYSA-N |
| XLogP | 8.28 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.71 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|