C21H23F3O4S — CID 164597311
6-[4-methyl-2-oxo-3-(trifluoromethyl)thiochromen-6-yl]oxyhexyl 2-methylprop-2-enoate (PubChem CID 164597311) has the molecular formula C21H23F3O4S and a molecular weight of 428.47 g/mol. Its IUPAC name is 6-[4-methyl-2-oxo-3-(trifluoromethyl)thiochromen-6-yl]oxyhexyl 2-methylprop-2-enoate.
| Compound Name | 6-[4-methyl-2-oxo-3-(trifluoromethyl)thiochromen-6-yl]oxyhexyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 164597311 |
| Molecular Formula | C21H23F3O4S |
| Molecular Weight | 428.47 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | 6-[4-methyl-2-oxo-3-(trifluoromethyl)thiochromen-6-yl]oxyhexyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCCCOc1ccc2sc(=O)c(C(F)(F)F)c(C)c2c1 |
| InChI | InChI=1S/C21H23F3O4S/c1-13(2)19(25)28-11-7-5-4-6-10-27-15-8-9-17-16(12-15)14(3)18(20(26)29-17)21(22,23)24/h8-9,12H,1,4-7,10-11H2,2-3H3 |
| InChIKey | JJKCCPLZNFRTKQ-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.47 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|