C20H23FO3S2 — CID 164597467
5-(3-fluoro-4-propyl-2-sulfanylidenethiochromen-6-yl)oxypentyl prop-2-enoate (PubChem CID 164597467) has the molecular formula C20H23FO3S2 and a molecular weight of 394.53 g/mol. Its IUPAC name is 5-(3-fluoro-4-propyl-2-sulfanylidenethiochromen-6-yl)oxypentyl prop-2-enoate.
| Compound Name | 5-(3-fluoro-4-propyl-2-sulfanylidenethiochromen-6-yl)oxypentyl prop-2-enoate |
|---|---|
| PubChem CID | 164597467 |
| Molecular Formula | C20H23FO3S2 |
| Molecular Weight | 394.53 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | 5-(3-fluoro-4-propyl-2-sulfanylidenethiochromen-6-yl)oxypentyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCOc1ccc2sc(=S)c(F)c(CCC)c2c1 |
| InChI | InChI=1S/C20H23FO3S2/c1-3-8-15-16-13-14(9-10-17(16)26-20(25)19(15)21)23-11-6-5-7-12-24-18(22)4-2/h4,9-10,13H,2-3,5-8,11-12H2,1H3 |
| InChIKey | SYVVTJJPKMRHLK-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.53 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|