C18H19FO5S — CID 164597316
2-[2-(4-ethyl-3-fluoro-2-oxothiochromen-7-yl)oxyethoxy]ethyl prop-2-enoate (PubChem CID 164597316) has the molecular formula C18H19FO5S and a molecular weight of 366.41 g/mol. Its IUPAC name is 2-[2-(4-ethyl-3-fluoro-2-oxothiochromen-7-yl)oxyethoxy]ethyl prop-2-enoate.
| Compound Name | 2-[2-(4-ethyl-3-fluoro-2-oxothiochromen-7-yl)oxyethoxy]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 164597316 |
| Molecular Formula | C18H19FO5S |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | 2-[2-(4-ethyl-3-fluoro-2-oxothiochromen-7-yl)oxyethoxy]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCOCCOc1ccc2c(CC)c(F)c(=O)sc2c1 |
| InChI | InChI=1S/C18H19FO5S/c1-3-13-14-6-5-12(11-15(14)25-18(21)17(13)19)23-9-7-22-8-10-24-16(20)4-2/h4-6,11H,2-3,7-10H2,1H3 |
| InChIKey | ISHMVDQNIGOIRV-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|