C22H27F3O4S — CID 164597307
6-[4-methyl-2-oxo-3-(trifluoromethyl)thiochromen-6-yl]oxyhexyl 2-methylbutanoate (PubChem CID 164597307) has the molecular formula C22H27F3O4S and a molecular weight of 444.52 g/mol. Its IUPAC name is 6-[4-methyl-2-oxo-3-(trifluoromethyl)thiochromen-6-yl]oxyhexyl 2-methylbutanoate.
| Compound Name | 6-[4-methyl-2-oxo-3-(trifluoromethyl)thiochromen-6-yl]oxyhexyl 2-methylbutanoate |
|---|---|
| PubChem CID | 164597307 |
| Molecular Formula | C22H27F3O4S |
| Molecular Weight | 444.52 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | 6-[4-methyl-2-oxo-3-(trifluoromethyl)thiochromen-6-yl]oxyhexyl 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OCCCCCCOc1ccc2sc(=O)c(C(F)(F)F)c(C)c2c1 |
| InChI | InChI=1S/C22H27F3O4S/c1-4-14(2)20(26)29-12-8-6-5-7-11-28-16-9-10-18-17(13-16)15(3)19(21(27)30-18)22(23,24)25/h9-10,13-14H,4-8,11-12H2,1-3H3 |
| InChIKey | CHVMNRGJEOAJNS-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.52 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|