C25H33FO4S2 — CID 164597446
7-(4-cyclohexyl-3-fluoro-1-oxo-2-sulfanylidenethiochromen-6-yl)oxyheptyl propanoate (PubChem CID 164597446) has the molecular formula C25H33FO4S2 and a molecular weight of 480.67 g/mol. Its IUPAC name is 7-(4-cyclohexyl-3-fluoro-1-oxo-2-sulfanylidenethiochromen-6-yl)oxyheptyl propanoate.
| Compound Name | 7-(4-cyclohexyl-3-fluoro-1-oxo-2-sulfanylidenethiochromen-6-yl)oxyheptyl propanoate |
|---|---|
| PubChem CID | 164597446 |
| Molecular Formula | C25H33FO4S2 |
| Molecular Weight | 480.67 g/mol |
| Exact Mass | 480.18 |
| IUPAC Name | 7-(4-cyclohexyl-3-fluoro-1-oxo-2-sulfanylidenethiochromen-6-yl)oxyheptyl propanoate |
| SMILES | CCC(=O)OCCCCCCCOc1ccc2c(c1)C(C1CCCCC1)=C(F)C(=S)S2=O |
| InChI | InChI=1S/C25H33FO4S2/c1-2-22(27)30-16-10-5-3-4-9-15-29-19-13-14-21-20(17-19)23(18-11-7-6-8-12-18)24(26)25(31)32(21)28/h13-14,17-18H,2-12,15-16H2,1H3 |
| InChIKey | PAUAKAYUUSKHHT-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.67 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|