C27H39FO4S3 — CID 164597237
2-[2-[2-(3-fluoro-4-propyl-2-sulfanylidenechromen-6-yl)sulfanylethoxy]ethylsulfanyl]ethyl 2,2,5-trimethylhexanoate (PubChem CID 164597237) has the molecular formula C27H39FO4S3 and a molecular weight of 542.80 g/mol. Its IUPAC name is 2-[2-[2-(3-fluoro-4-propyl-2-sulfanylidenechromen-6-yl)sulfanylethoxy]ethylsulfanyl]ethyl 2,2,5-trimethylhexanoate.
| Compound Name | 2-[2-[2-(3-fluoro-4-propyl-2-sulfanylidenechromen-6-yl)sulfanylethoxy]ethylsulfanyl]ethyl 2,2,5-trimethylhexanoate |
|---|---|
| PubChem CID | 164597237 |
| Molecular Formula | C27H39FO4S3 |
| Molecular Weight | 542.80 g/mol |
| Exact Mass | 542.20 |
| IUPAC Name | 2-[2-[2-(3-fluoro-4-propyl-2-sulfanylidenechromen-6-yl)sulfanylethoxy]ethylsulfanyl]ethyl 2,2,5-trimethylhexanoate |
| SMILES | CCCc1c(F)c(=S)oc2ccc(SCCOCCSCCOC(=O)C(C)(C)CCC(C)C)cc12 |
| InChI | InChI=1S/C27H39FO4S3/c1-6-7-21-22-18-20(8-9-23(22)32-25(33)24(21)28)35-17-13-30-12-15-34-16-14-31-26(29)27(4,5)11-10-19(2)3/h8-9,18-19H,6-7,10-17H2,1-5H3 |
| InChIKey | VZIBUVMVCDWOPM-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.80 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|