C28H33F3O2S2 — CID 91367366
[4-[3-[1-benzyl-2-(trifluoromethyl)thiophen-1-yl]heptylsulfanyl]-2-methylphenyl] acetate (PubChem CID 91367366) has the molecular formula C28H33F3O2S2 and a molecular weight of 522.70 g/mol. Its IUPAC name is [4-[3-[1-benzyl-2-(trifluoromethyl)thiophen-1-yl]heptylsulfanyl]-2-methylphenyl] acetate.
| Compound Name | [4-[3-[1-benzyl-2-(trifluoromethyl)thiophen-1-yl]heptylsulfanyl]-2-methylphenyl] acetate |
|---|---|
| PubChem CID | 91367366 |
| Molecular Formula | C28H33F3O2S2 |
| Molecular Weight | 522.70 g/mol |
| Exact Mass | 522.19 |
| IUPAC Name | [4-[3-[1-benzyl-2-(trifluoromethyl)thiophen-1-yl]heptylsulfanyl]-2-methylphenyl] acetate |
| SMILES | CCCCC(CCSc1ccc(OC(C)=O)c(C)c1)S1(Cc2ccccc2)C=CC=C1C(F)(F)F |
| InChI | InChI=1S/C28H33F3O2S2/c1-4-5-12-25(16-17-34-24-14-15-26(21(2)19-24)33-22(3)32)35(20-23-10-7-6-8-11-23)18-9-13-27(35)28(29,30)31/h6-11,13-15,18-19,25H,4-5,12,16-17,20H2,1-3H3 |
| InChIKey | VFGBTRZXSFYKAH-UHFFFAOYSA-N |
| XLogP | 8.94 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.70 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|