C26H29F3O2S2 — CID 91350637
[4-[3-[1-benzyl-4-methyl-2-(trifluoromethyl)thiophen-1-yl]propylsulfanyl]-2-ethylphenyl] acetate (PubChem CID 91350637) has the molecular formula C26H29F3O2S2 and a molecular weight of 494.64 g/mol. Its IUPAC name is [4-[3-[1-benzyl-4-methyl-2-(trifluoromethyl)thiophen-1-yl]propylsulfanyl]-2-ethylphenyl] acetate.
| Compound Name | [4-[3-[1-benzyl-4-methyl-2-(trifluoromethyl)thiophen-1-yl]propylsulfanyl]-2-ethylphenyl] acetate |
|---|---|
| PubChem CID | 91350637 |
| Molecular Formula | C26H29F3O2S2 |
| Molecular Weight | 494.64 g/mol |
| Exact Mass | 494.16 |
| IUPAC Name | [4-[3-[1-benzyl-4-methyl-2-(trifluoromethyl)thiophen-1-yl]propylsulfanyl]-2-ethylphenyl] acetate |
| SMILES | CCc1cc(SCCCS2(Cc3ccccc3)C=C(C)C=C2C(F)(F)F)ccc1OC(C)=O |
| InChI | InChI=1S/C26H29F3O2S2/c1-4-22-16-23(11-12-24(22)31-20(3)30)32-13-8-14-33(18-21-9-6-5-7-10-21)17-19(2)15-25(33)26(27,28)29/h5-7,9-12,15-17H,4,8,13-14,18H2,1-3H3 |
| InChIKey | FAMNKJKXWPCDMG-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.64 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|