C28H39F3O3S2 — CID 164597493
S-[8-[4-methyl-2-oxo-3-(trifluoromethyl)thiochromen-5-yl]oxyoctyl] 2,2,5-trimethylhexanethioate (PubChem CID 164597493) has the molecular formula C28H39F3O3S2 and a molecular weight of 544.75 g/mol. Its IUPAC name is S-[8-[4-methyl-2-oxo-3-(trifluoromethyl)thiochromen-5-yl]oxyoctyl] 2,2,5-trimethylhexanethioate.
| Compound Name | S-[8-[4-methyl-2-oxo-3-(trifluoromethyl)thiochromen-5-yl]oxyoctyl] 2,2,5-trimethylhexanethioate |
|---|---|
| PubChem CID | 164597493 |
| Molecular Formula | C28H39F3O3S2 |
| Molecular Weight | 544.75 g/mol |
| Exact Mass | 544.23 |
| IUPAC Name | S-[8-[4-methyl-2-oxo-3-(trifluoromethyl)thiochromen-5-yl]oxyoctyl] 2,2,5-trimethylhexanethioate |
| SMILES | Cc1c(C(F)(F)F)c(=O)sc2cccc(OCCCCCCCCSC(=O)C(C)(C)CCC(C)C)c12 |
| InChI | InChI=1S/C28H39F3O3S2/c1-19(2)15-16-27(4,5)26(33)35-18-11-9-7-6-8-10-17-34-21-13-12-14-22-23(21)20(3)24(25(32)36-22)28(29,30)31/h12-14,19H,6-11,15-18H2,1-5H3 |
| InChIKey | CPBRAXYKVUHEMF-UHFFFAOYSA-N |
| XLogP | 9.03 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.75 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|