C24H33FO3S2 — CID 164525113
S-[6-(6-fluoro-2-sulfanylidenechromen-3-yl)oxyhexyl] 2,2,5-trimethylhexanethioate (PubChem CID 164525113) has the molecular formula C24H33FO3S2 and a molecular weight of 452.66 g/mol. Its IUPAC name is S-[6-(6-fluoro-2-sulfanylidenechromen-3-yl)oxyhexyl] 2,2,5-trimethylhexanethioate.
| Compound Name | S-[6-(6-fluoro-2-sulfanylidenechromen-3-yl)oxyhexyl] 2,2,5-trimethylhexanethioate |
|---|---|
| PubChem CID | 164525113 |
| Molecular Formula | C24H33FO3S2 |
| Molecular Weight | 452.66 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | S-[6-(6-fluoro-2-sulfanylidenechromen-3-yl)oxyhexyl] 2,2,5-trimethylhexanethioate |
| SMILES | CC(C)CCC(C)(C)C(=O)SCCCCCCOc1cc2cc(F)ccc2oc1=S |
| InChI | InChI=1S/C24H33FO3S2/c1-17(2)11-12-24(3,4)23(26)30-14-8-6-5-7-13-27-21-16-18-15-19(25)9-10-20(18)28-22(21)29/h9-10,15-17H,5-8,11-14H2,1-4H3 |
| InChIKey | KDZVOTKRVODOQZ-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.66 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|