C26H33F5O3S2 — CID 164597245
S-[10-[4-methyl-2-oxo-3-(1,1,2,2,2-pentafluoroethyl)thiochromen-7-yl]oxydecyl] 2-methylpropanethioate (PubChem CID 164597245) has the molecular formula C26H33F5O3S2 and a molecular weight of 552.67 g/mol. Its IUPAC name is S-[10-[4-methyl-2-oxo-3-(1,1,2,2,2-pentafluoroethyl)thiochromen-7-yl]oxydecyl] 2-methylpropanethioate.
| Compound Name | S-[10-[4-methyl-2-oxo-3-(1,1,2,2,2-pentafluoroethyl)thiochromen-7-yl]oxydecyl] 2-methylpropanethioate |
|---|---|
| PubChem CID | 164597245 |
| Molecular Formula | C26H33F5O3S2 |
| Molecular Weight | 552.67 g/mol |
| Exact Mass | 552.18 |
| IUPAC Name | S-[10-[4-methyl-2-oxo-3-(1,1,2,2,2-pentafluoroethyl)thiochromen-7-yl]oxydecyl] 2-methylpropanethioate |
| SMILES | Cc1c(C(F)(F)C(F)(F)F)c(=O)sc2cc(OCCCCCCCCCCSC(=O)C(C)C)ccc12 |
| InChI | InChI=1S/C26H33F5O3S2/c1-17(2)23(32)35-15-11-9-7-5-4-6-8-10-14-34-19-12-13-20-18(3)22(24(33)36-21(20)16-19)25(27,28)26(29,30)31/h12-13,16-17H,4-11,14-15H2,1-3H3 |
| InChIKey | QNQIZOGWYGVLJM-UHFFFAOYSA-N |
| XLogP | 8.64 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.67 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|