C31H41F5O3S2 — CID 58666066
(3S,4S)-7-methoxy-3-(4-methoxyphenyl)-3-methyl-4-[3-[5-(4,4,5,5,5-pentafluoropentylsulfanyl)pentoxy]propyl]-2,4-dihydrothiochromene (PubChem CID 58666066) has the molecular formula C31H41F5O3S2 and a molecular weight of 620.79 g/mol. Its IUPAC name is (3S,4S)-7-methoxy-3-(4-methoxyphenyl)-3-methyl-4-[3-[5-(4,4,5,5,5-pentafluoropentylsulfanyl)pentoxy]propyl]-2,4-dihydrothiochromene.
| Compound Name | (3S,4S)-7-methoxy-3-(4-methoxyphenyl)-3-methyl-4-[3-[5-(4,4,5,5,5-pentafluoropentylsulfanyl)pentoxy]propyl]-2,4-dihydrothiochromene |
|---|---|
| PubChem CID | 58666066 |
| Molecular Formula | C31H41F5O3S2 |
| Molecular Weight | 620.79 g/mol |
| Exact Mass | 620.24 |
| IUPAC Name | (3S,4S)-7-methoxy-3-(4-methoxyphenyl)-3-methyl-4-[3-[5-(4,4,5,5,5-pentafluoropentylsulfanyl)pentoxy]propyl]-2,4-dihydrothiochromene |
| SMILES | COc1ccc([C@@]2(C)CSc3cc(OC)ccc3[C@H]2CCCOCCCCCSCCCC(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C31H41F5O3S2/c1-29(23-10-12-24(37-2)13-11-23)22-41-28-21-25(38-3)14-15-26(28)27(29)9-7-18-39-17-5-4-6-19-40-20-8-16-30(32,33)31(34,35)36/h10-15,21,27H,4-9,16-20,22H2,1-3H3/t27-,29-/m1/s1 |
| InChIKey | OZPIPHLTCPPXFM-XRKRLSELSA-N |
| XLogP | 9.53 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.79 |
| LogP ≤ 5 | 9.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|