C28H39F3O4S — CID 164597435
8-[4-methyl-2-oxo-3-(trifluoromethyl)thiochromen-5-yl]oxyoctyl 2,2,3,4-tetramethylpentanoate (PubChem CID 164597435) has the molecular formula C28H39F3O4S and a molecular weight of 528.68 g/mol. Its IUPAC name is 8-[4-methyl-2-oxo-3-(trifluoromethyl)thiochromen-5-yl]oxyoctyl 2,2,3,4-tetramethylpentanoate.
| Compound Name | 8-[4-methyl-2-oxo-3-(trifluoromethyl)thiochromen-5-yl]oxyoctyl 2,2,3,4-tetramethylpentanoate |
|---|---|
| PubChem CID | 164597435 |
| Molecular Formula | C28H39F3O4S |
| Molecular Weight | 528.68 g/mol |
| Exact Mass | 528.25 |
| IUPAC Name | 8-[4-methyl-2-oxo-3-(trifluoromethyl)thiochromen-5-yl]oxyoctyl 2,2,3,4-tetramethylpentanoate |
| SMILES | Cc1c(C(F)(F)F)c(=O)sc2cccc(OCCCCCCCCOC(=O)C(C)(C)C(C)C(C)C)c12 |
| InChI | InChI=1S/C28H39F3O4S/c1-18(2)20(4)27(5,6)26(33)35-17-12-10-8-7-9-11-16-34-21-14-13-15-22-23(21)19(3)24(25(32)36-22)28(29,30)31/h13-15,18,20H,7-12,16-17H2,1-6H3 |
| InChIKey | AGYWECCNHMLBOP-UHFFFAOYSA-N |
| XLogP | 8.17 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.68 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|