C28H31O3S2+ — CID 138961674
methyl 5-(2,5-dimethyl-4-thianthren-5-ium-5-ylphenoxy)-2,2-dimethylpentanoate (PubChem CID 138961674) has the molecular formula C28H31O3S2+ and a molecular weight of 479.69 g/mol. Its IUPAC name is methyl 5-(2,5-dimethyl-4-thianthren-5-ium-5-ylphenoxy)-2,2-dimethylpentanoate.
| Compound Name | methyl 5-(2,5-dimethyl-4-thianthren-5-ium-5-ylphenoxy)-2,2-dimethylpentanoate |
|---|---|
| PubChem CID | 138961674 |
| Molecular Formula | C28H31O3S2+ |
| Molecular Weight | 479.69 g/mol |
| Exact Mass | 479.17 |
| IUPAC Name | methyl 5-(2,5-dimethyl-4-thianthren-5-ium-5-ylphenoxy)-2,2-dimethylpentanoate |
| SMILES | COC(=O)C(C)(C)CCCOc1cc(C)c([S+]2c3ccccc3Sc3ccccc32)cc1C |
| InChI | InChI=1S/C28H31O3S2/c1-19-18-26(20(2)17-21(19)31-16-10-15-28(3,4)27(29)30-5)33-24-13-8-6-11-22(24)32-23-12-7-9-14-25(23)33/h6-9,11-14,17-18H,10,15-16H2,1-5H3/q+1 |
| InChIKey | NMJNWAADXYVZBY-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.69 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|