C35H28O4S2 — CID 11203966
4-(2,5-dimethylphenyl)sulfanyl-3-[[4-(2,5-dimethylphenyl)sulfanyl-2-oxochromen-3-yl]methyl]chromen-2-one (PubChem CID 11203966) has the molecular formula C35H28O4S2 and a molecular weight of 576.74 g/mol. Its IUPAC name is 4-(2,5-dimethylphenyl)sulfanyl-3-[[4-(2,5-dimethylphenyl)sulfanyl-2-oxochromen-3-yl]methyl]chromen-2-one.
| Compound Name | 4-(2,5-dimethylphenyl)sulfanyl-3-[[4-(2,5-dimethylphenyl)sulfanyl-2-oxochromen-3-yl]methyl]chromen-2-one |
|---|---|
| PubChem CID | 11203966 |
| Molecular Formula | C35H28O4S2 |
| Molecular Weight | 576.74 g/mol |
| Exact Mass | 576.14 |
| IUPAC Name | 4-(2,5-dimethylphenyl)sulfanyl-3-[[4-(2,5-dimethylphenyl)sulfanyl-2-oxochromen-3-yl]methyl]chromen-2-one |
| SMILES | Cc1ccc(C)c(Sc2c(Cc3c(Sc4cc(C)ccc4C)c4ccccc4oc3=O)c(=O)oc3ccccc23)c1 |
| InChI | InChI=1S/C35H28O4S2/c1-20-13-15-22(3)30(17-20)40-32-24-9-5-7-11-28(24)38-34(36)26(32)19-27-33(41-31-18-21(2)14-16-23(31)4)25-10-6-8-12-29(25)39-35(27)37/h5-18H,19H2,1-4H3 |
| InChIKey | BWOSAUGXNFZDEA-UHFFFAOYSA-N |
| XLogP | 9.03 |
| TPSA | 60.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.74 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|