C31H18Br2O4S2 — CID 20633781
4-(4-bromophenyl)sulfanyl-3-[[4-(2-bromophenyl)sulfanyl-2-oxochromen-3-yl]methyl]chromen-2-one (PubChem CID 20633781) has the molecular formula C31H18Br2O4S2 and a molecular weight of 678.42 g/mol. Its IUPAC name is 4-(4-bromophenyl)sulfanyl-3-[[4-(2-bromophenyl)sulfanyl-2-oxochromen-3-yl]methyl]chromen-2-one.
| Compound Name | 4-(4-bromophenyl)sulfanyl-3-[[4-(2-bromophenyl)sulfanyl-2-oxochromen-3-yl]methyl]chromen-2-one |
|---|---|
| PubChem CID | 20633781 |
| Molecular Formula | C31H18Br2O4S2 |
| Molecular Weight | 678.42 g/mol |
| Exact Mass | 675.90 |
| IUPAC Name | 4-(4-bromophenyl)sulfanyl-3-[[4-(2-bromophenyl)sulfanyl-2-oxochromen-3-yl]methyl]chromen-2-one |
| SMILES | O=c1oc2ccccc2c(Sc2ccc(Br)cc2)c1Cc1c(Sc2ccccc2Br)c2ccccc2oc1=O |
| InChI | InChI=1S/C31H18Br2O4S2/c32-18-13-15-19(16-14-18)38-28-20-7-1-4-10-25(20)36-30(34)22(28)17-23-29(39-27-12-6-3-9-24(27)33)21-8-2-5-11-26(21)37-31(23)35/h1-16H,17H2 |
| InChIKey | NAIFMMDAPIGXCM-UHFFFAOYSA-N |
| XLogP | 9.32 |
| TPSA | 60.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.42 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|