C32H20F4O4S2 — CID 10371504
3-[[4-[(3E,5E)-5,7-difluorohepta-1,3,5-trien-4-yl]sulfanyl-2-oxochromen-3-yl]methyl]-4-(2,4-difluorophenyl)sulfanylchromen-2-one (PubChem CID 10371504) has the molecular formula C32H20F4O4S2 and a molecular weight of 608.63 g/mol. Its IUPAC name is 3-[[4-[(3E,5E)-5,7-difluorohepta-1,3,5-trien-4-yl]sulfanyl-2-oxochromen-3-yl]methyl]-4-(2,4-difluorophenyl)sulfanylchromen-2-one.
| Compound Name | 3-[[4-[(3E,5E)-5,7-difluorohepta-1,3,5-trien-4-yl]sulfanyl-2-oxochromen-3-yl]methyl]-4-(2,4-difluorophenyl)sulfanylchromen-2-one |
|---|---|
| PubChem CID | 10371504 |
| Molecular Formula | C32H20F4O4S2 |
| Molecular Weight | 608.63 g/mol |
| Exact Mass | 608.07 |
| IUPAC Name | 3-[[4-[(3E,5E)-5,7-difluorohepta-1,3,5-trien-4-yl]sulfanyl-2-oxochromen-3-yl]methyl]-4-(2,4-difluorophenyl)sulfanylchromen-2-one |
| SMILES | C=C/C=C(Sc1c(Cc2c(Sc3ccc(F)cc3F)c3ccccc3oc2=O)c(=O)oc2ccccc12)\C(F)=C/CF |
| InChI | InChI=1S/C32H20F4O4S2/c1-2-7-27(23(35)14-15-33)41-29-19-8-3-5-10-25(19)39-31(37)21(29)17-22-30(42-28-13-12-18(34)16-24(28)36)20-9-4-6-11-26(20)40-32(22)38/h2-14,16H,1,15,17H2/b23-14+,27-7+ |
| InChIKey | HHJSNIGNHHFXKH-YQQVDQSJSA-N |
| XLogP | 8.90 |
| TPSA | 60.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.63 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|