C32H22F2O4S2 — CID 11757790
3-[[4-[(3E,5E)-5-fluorohepta-1,3,5-trien-4-yl]sulfanyl-2-oxochromen-3-yl]methyl]-4-(2-fluorophenyl)sulfanylchromen-2-one (PubChem CID 11757790) has the molecular formula C32H22F2O4S2 and a molecular weight of 572.65 g/mol. Its IUPAC name is 3-[[4-[(3E,5E)-5-fluorohepta-1,3,5-trien-4-yl]sulfanyl-2-oxochromen-3-yl]methyl]-4-(2-fluorophenyl)sulfanylchromen-2-one.
| Compound Name | 3-[[4-[(3E,5E)-5-fluorohepta-1,3,5-trien-4-yl]sulfanyl-2-oxochromen-3-yl]methyl]-4-(2-fluorophenyl)sulfanylchromen-2-one |
|---|---|
| PubChem CID | 11757790 |
| Molecular Formula | C32H22F2O4S2 |
| Molecular Weight | 572.65 g/mol |
| Exact Mass | 572.09 |
| IUPAC Name | 3-[[4-[(3E,5E)-5-fluorohepta-1,3,5-trien-4-yl]sulfanyl-2-oxochromen-3-yl]methyl]-4-(2-fluorophenyl)sulfanylchromen-2-one |
| SMILES | C=C/C=C(Sc1c(Cc2c(Sc3ccccc3F)c3ccccc3oc2=O)c(=O)oc2ccccc12)\C(F)=C/C |
| InChI | InChI=1S/C32H22F2O4S2/c1-3-11-27(23(33)4-2)39-29-19-12-5-8-15-25(19)37-31(35)21(29)18-22-30(40-28-17-10-7-14-24(28)34)20-13-6-9-16-26(20)38-32(22)36/h3-17H,1,18H2,2H3/b23-4+,27-11+ |
| InChIKey | VVXDWQPPQMPWFX-KMPFRWFZSA-N |
| XLogP | 8.82 |
| TPSA | 60.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.65 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|