C21H26O3S — CID 154716510
5-(2,5-dimethylphenoxy)-2-methyl-2-(phenylsulfanylmethyl)pentanoic acid (PubChem CID 154716510) has the molecular formula C21H26O3S and a molecular weight of 358.50 g/mol. Its IUPAC name is 5-(2,5-dimethylphenoxy)-2-methyl-2-(phenylsulfanylmethyl)pentanoic acid.
| Compound Name | 5-(2,5-dimethylphenoxy)-2-methyl-2-(phenylsulfanylmethyl)pentanoic acid |
|---|---|
| PubChem CID | 154716510 |
| Molecular Formula | C21H26O3S |
| Molecular Weight | 358.50 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | 5-(2,5-dimethylphenoxy)-2-methyl-2-(phenylsulfanylmethyl)pentanoic acid |
| SMILES | Cc1ccc(C)c(OCCCC(C)(CSc2ccccc2)C(=O)O)c1 |
| InChI | InChI=1S/C21H26O3S/c1-16-10-11-17(2)19(14-16)24-13-7-12-21(3,20(22)23)15-25-18-8-5-4-6-9-18/h4-6,8-11,14H,7,12-13,15H2,1-3H3,(H,22,23) |
| InChIKey | BQLICTJZHWFEJY-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.50 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|