C22H25N5O2 — CID 165436808
5-cyano-N-[3-(2-methoxyphenyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-5-yl]-3-methylpyridine-2-carboxamide (PubChem CID 165436808) has the molecular formula C22H25N5O2 and a molecular weight of 391.48 g/mol. Its IUPAC name is 5-cyano-N-[3-(2-methoxyphenyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-5-yl]-3-methylpyridine-2-carboxamide.
| Compound Name | 5-cyano-N-[3-(2-methoxyphenyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-5-yl]-3-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 165436808 |
| Molecular Formula | C22H25N5O2 |
| Molecular Weight | 391.48 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | 5-cyano-N-[3-(2-methoxyphenyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-5-yl]-3-methylpyridine-2-carboxamide |
| SMILES | COc1ccccc1C1NNC2CCC(NC(=O)c3ncc(C#N)cc3C)CC21 |
| InChI | InChI=1S/C22H25N5O2/c1-13-9-14(11-23)12-24-20(13)22(28)25-15-7-8-18-17(10-15)21(27-26-18)16-5-3-4-6-19(16)29-2/h3-6,9,12,15,17-18,21,26-27H,7-8,10H2,1-2H3,(H,25,28) |
| InChIKey | KABBEHGJVXGNGG-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 99.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.48 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |