C27H34N6O2 — CID 165436825
5-cyano-N-[3-[3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]phenyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-5-yl]-3-methylpyridine-2-carboxamide (PubChem CID 165436825) has the molecular formula C27H34N6O2 and a molecular weight of 474.61 g/mol. Its IUPAC name is 5-cyano-N-[3-[3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]phenyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-5-yl]-3-methylpyridine-2-carboxamide.
| Compound Name | 5-cyano-N-[3-[3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]phenyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-5-yl]-3-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 165436825 |
| Molecular Formula | C27H34N6O2 |
| Molecular Weight | 474.61 g/mol |
| Exact Mass | 474.27 |
| IUPAC Name | 5-cyano-N-[3-[3-[(2S,6R)-2,6-dimethylmorpholin-4-yl]phenyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-5-yl]-3-methylpyridine-2-carboxamide |
| SMILES | Cc1cc(C#N)cnc1C(=O)NC1CCC2NNC(c3cccc(N4C[C@@H](C)O[C@@H](C)C4)c3)C2C1 |
| InChI | InChI=1S/C27H34N6O2/c1-16-9-19(12-28)13-29-25(16)27(34)30-21-7-8-24-23(11-21)26(32-31-24)20-5-4-6-22(10-20)33-14-17(2)35-18(3)15-33/h4-6,9-10,13,17-18,21,23-24,26,31-32H,7-8,11,14-15H2,1-3H3,(H,30,34)/t17-,18+,21?,23?,24?,26? |
| InChIKey | LHPSOEMZGDHUPQ-IHNZNUNGSA-N |
| XLogP | 2.99 |
| TPSA | 102.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.61 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |