C20H20N6OS — CID 165436835
5-cyano-N-[3-(4-cyanothiophen-2-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-5-yl]-3-methylpyridine-2-carboxamide (PubChem CID 165436835) has the molecular formula C20H20N6OS and a molecular weight of 392.49 g/mol. Its IUPAC name is 5-cyano-N-[3-(4-cyanothiophen-2-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-5-yl]-3-methylpyridine-2-carboxamide.
| Compound Name | 5-cyano-N-[3-(4-cyanothiophen-2-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-5-yl]-3-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 165436835 |
| Molecular Formula | C20H20N6OS |
| Molecular Weight | 392.49 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | 5-cyano-N-[3-(4-cyanothiophen-2-yl)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-5-yl]-3-methylpyridine-2-carboxamide |
| SMILES | Cc1cc(C#N)cnc1C(=O)NC1CCC2NNC(c3cc(C#N)cs3)C2C1 |
| InChI | InChI=1S/C20H20N6OS/c1-11-4-12(7-21)9-23-18(11)20(27)24-14-2-3-16-15(6-14)19(26-25-16)17-5-13(8-22)10-28-17/h4-5,9-10,14-16,19,25-26H,2-3,6H2,1H3,(H,24,27) |
| InChIKey | JGXMZTXDWYSRMM-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 113.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.49 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |