C18H20N2O5 — CID 165437332
N-(6-anilino-6-oxohexyl)-5-hydroxy-4-oxopyran-2-carboxamide (PubChem CID 165437332) has the molecular formula C18H20N2O5 and a molecular weight of 344.37 g/mol. Its IUPAC name is N-(6-anilino-6-oxohexyl)-5-hydroxy-4-oxopyran-2-carboxamide.
| Compound Name | N-(6-anilino-6-oxohexyl)-5-hydroxy-4-oxopyran-2-carboxamide |
|---|---|
| PubChem CID | 165437332 |
| Molecular Formula | C18H20N2O5 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | N-(6-anilino-6-oxohexyl)-5-hydroxy-4-oxopyran-2-carboxamide |
| SMILES | O=C(CCCCCNC(=O)c1cc(=O)c(O)co1)Nc1ccccc1 |
| InChI | InChI=1S/C18H20N2O5/c21-14-11-16(25-12-15(14)22)18(24)19-10-6-2-5-9-17(23)20-13-7-3-1-4-8-13/h1,3-4,7-8,11-12,22H,2,5-6,9-10H2,(H,19,24)(H,20,23) |
| InChIKey | AZYFXNZRJYWEKC-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 108.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|