C19H22N2O5 — CID 165437357
N-(7-anilino-7-oxoheptyl)-5-hydroxy-4-oxopyran-2-carboxamide (PubChem CID 165437357) has the molecular formula C19H22N2O5 and a molecular weight of 358.39 g/mol. Its IUPAC name is N-(7-anilino-7-oxoheptyl)-5-hydroxy-4-oxopyran-2-carboxamide.
| Compound Name | N-(7-anilino-7-oxoheptyl)-5-hydroxy-4-oxopyran-2-carboxamide |
|---|---|
| PubChem CID | 165437357 |
| Molecular Formula | C19H22N2O5 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | N-(7-anilino-7-oxoheptyl)-5-hydroxy-4-oxopyran-2-carboxamide |
| SMILES | O=C(CCCCCCNC(=O)c1cc(=O)c(O)co1)Nc1ccccc1 |
| InChI | InChI=1S/C19H22N2O5/c22-15-12-17(26-13-16(15)23)19(25)20-11-7-2-1-6-10-18(24)21-14-8-4-3-5-9-14/h3-5,8-9,12-13,23H,1-2,6-7,10-11H2,(H,20,25)(H,21,24) |
| InChIKey | ANCQJGQDKRVZGF-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 108.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|