C20H24N2O5 — CID 166436518
N-(8-anilino-8-oxooctyl)-5-hydroxy-4-oxopyran-2-carboxamide (PubChem CID 166436518) has the molecular formula C20H24N2O5 and a molecular weight of 372.42 g/mol. Its IUPAC name is N-(8-anilino-8-oxooctyl)-5-hydroxy-4-oxopyran-2-carboxamide.
| Compound Name | N-(8-anilino-8-oxooctyl)-5-hydroxy-4-oxopyran-2-carboxamide |
|---|---|
| PubChem CID | 166436518 |
| Molecular Formula | C20H24N2O5 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | N-(8-anilino-8-oxooctyl)-5-hydroxy-4-oxopyran-2-carboxamide |
| SMILES | O=C(CCCCCCCNC(=O)c1cc(=O)c(O)co1)Nc1ccccc1 |
| InChI | InChI=1S/C20H24N2O5/c23-16-13-18(27-14-17(16)24)20(26)21-12-8-3-1-2-7-11-19(25)22-15-9-5-4-6-10-15/h4-6,9-10,13-14,24H,1-3,7-8,11-12H2,(H,21,26)(H,22,25) |
| InChIKey | YSAZXODPSOTHTE-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 108.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|