C41H41NO3 — CID 165437796
(2-propan-2-ylphenyl) 7-butyl-3-hydroxy-4-[2-(2-phenylpropan-2-yl)-1H-indol-3-yl]naphthalene-2-carboxylate (PubChem CID 165437796) has the molecular formula C41H41NO3 and a molecular weight of 595.78 g/mol. Its IUPAC name is (2-propan-2-ylphenyl) 7-butyl-3-hydroxy-4-[2-(2-phenylpropan-2-yl)-1H-indol-3-yl]naphthalene-2-carboxylate.
| Compound Name | (2-propan-2-ylphenyl) 7-butyl-3-hydroxy-4-[2-(2-phenylpropan-2-yl)-1H-indol-3-yl]naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 165437796 |
| Molecular Formula | C41H41NO3 |
| Molecular Weight | 595.78 g/mol |
| Exact Mass | 595.31 |
| IUPAC Name | (2-propan-2-ylphenyl) 7-butyl-3-hydroxy-4-[2-(2-phenylpropan-2-yl)-1H-indol-3-yl]naphthalene-2-carboxylate |
| SMILES | CCCCc1ccc2c(-c3c(C(C)(C)c4ccccc4)[nH]c4ccccc34)c(O)c(C(=O)Oc3ccccc3C(C)C)cc2c1 |
| InChI | InChI=1S/C41H41NO3/c1-6-7-15-27-22-23-31-28(24-27)25-33(40(44)45-35-21-14-12-18-30(35)26(2)3)38(43)36(31)37-32-19-11-13-20-34(32)42-39(37)41(4,5)29-16-9-8-10-17-29/h8-14,16-26,42-43H,6-7,15H2,1-5H3 |
| InChIKey | MTBIIAAHUQVXPE-UHFFFAOYSA-N |
| XLogP | 10.70 |
| TPSA | 62.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.78 |
| LogP ≤ 5 | 10.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|