C7H14N4 — CID 165438711
4-(ethylaminomethyl)-1-methylpyrazol-3-amine (PubChem CID 165438711) has the molecular formula C7H14N4 and a molecular weight of 154.22 g/mol. Its IUPAC name is 4-(ethylaminomethyl)-1-methylpyrazol-3-amine.
| Compound Name | 4-(ethylaminomethyl)-1-methylpyrazol-3-amine |
|---|---|
| PubChem CID | 165438711 |
| Molecular Formula | C7H14N4 |
| Molecular Weight | 154.22 g/mol |
| Exact Mass | 154.12 |
| IUPAC Name | 4-(ethylaminomethyl)-1-methylpyrazol-3-amine |
| SMILES | CCNCc1cn(C)nc1N |
| InChI | InChI=1S/C7H14N4/c1-3-9-4-6-5-11(2)10-7(6)8/h5,9H,3-4H2,1-2H3,(H2,8,10) |
| InChIKey | NIAAWFREXXVSJB-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.22 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |