C9H16N4O2 — CID 165439104
2-[(3-amino-1-methylpyrazol-4-yl)methylamino]butanoic acid (PubChem CID 165439104) has the molecular formula C9H16N4O2 and a molecular weight of 212.25 g/mol. Its IUPAC name is 2-[(3-amino-1-methylpyrazol-4-yl)methylamino]butanoic acid.
| Compound Name | 2-[(3-amino-1-methylpyrazol-4-yl)methylamino]butanoic acid |
|---|---|
| PubChem CID | 165439104 |
| Molecular Formula | C9H16N4O2 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | 2-[(3-amino-1-methylpyrazol-4-yl)methylamino]butanoic acid |
| SMILES | CCC(NCc1cn(C)nc1N)C(=O)O |
| InChI | InChI=1S/C9H16N4O2/c1-3-7(9(14)15)11-4-6-5-13(2)12-8(6)10/h5,7,11H,3-4H2,1-2H3,(H2,10,12)(H,14,15) |
| InChIKey | RWQYWHINVLFOFT-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 93.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |